Difference between revisions of "CPD-14873"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3661 RXN-3661] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....") |
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-14873 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-amino-4-hydroxybenzoate |
| − | * | + | * smiles: |
| − | ** | + | ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) |
| − | = | + | * inchi-key: |
| − | + | ** mrbkrzapgucwos-uhfffaoysa-m | |
| − | + | * molecular-weight: | |
| − | * | + | ** 152.129 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-15414]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | ** | + | {{#set: common-name=3-amino-4-hydroxybenzoate}} |
| − | + | {{#set: inchi-key=inchikey=mrbkrzapgucwos-uhfffaoysa-m}} | |
| − | + | {{#set: molecular-weight=152.129}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-14873
- common-name:
- 3-amino-4-hydroxybenzoate
- smiles:
- c(=o)([o-])c1(c=c(n)c(o)=cc=1)
- inchi-key:
- mrbkrzapgucwos-uhfffaoysa-m
- molecular-weight:
- 152.129
