Difference between revisions of "CPD-14874"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12179 == * common-name: ** methylmalonate semialdehyde == Reaction(s) known to consume the compound == * 1.2.1.27-RXN == Reaction...") |
(Created page with "Category:metabolite == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == * common-name: ** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine * smiles: ** cc(=o)nc2(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine |
| + | * smiles: | ||
| + | ** cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2) | ||
| + | * inchi-key: | ||
| + | ** kfeujdwyngmdbv-rphkzzmbsa-n | ||
| + | * molecular-weight: | ||
| + | ** 383.352 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15268]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]] | ||
| + | * [[RXN-15268]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine}} |
| + | {{#set: inchi-key=inchikey=kfeujdwyngmdbv-rphkzzmbsa-n}} | ||
| + | {{#set: molecular-weight=383.352}} | ||
Revision as of 11:19, 15 January 2021
Contents
Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE
- common-name:
- β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine
- smiles:
- cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
- inchi-key:
- kfeujdwyngmdbv-rphkzzmbsa-n
- molecular-weight:
- 383.352
