Difference between revisions of "CPD-14874"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == * common-name: ** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine * smiles: ** cc(=o)nc2(...")
(Created page with "Category:metabolite == Metabolite CPD-14874 == * common-name: ** grixazone a * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c([ch]=o)c=3))) * inchi-ke...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE ==
+
== Metabolite CPD-14874 ==
 
* common-name:
 
* common-name:
** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine
+
** grixazone a
 
* smiles:
 
* smiles:
** cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
+
** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c([ch]=o)c=3)))
 
* inchi-key:
 
* inchi-key:
** kfeujdwyngmdbv-rphkzzmbsa-n
+
** cbxhedpbkozzsi-nshdsacasa-m
 
* molecular-weight:
 
* molecular-weight:
** 383.352
+
** 400.385
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15268]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
+
* [[RXN-13868]]
* [[RXN-15268]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine}}
+
{{#set: common-name=grixazone a}}
{{#set: inchi-key=inchikey=kfeujdwyngmdbv-rphkzzmbsa-n}}
+
{{#set: inchi-key=inchikey=cbxhedpbkozzsi-nshdsacasa-m}}
{{#set: molecular-weight=383.352}}
+
{{#set: molecular-weight=400.385}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-14874

  • common-name:
    • grixazone a
  • smiles:
    • cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c([ch]=o)c=3)))
  • inchi-key:
    • cbxhedpbkozzsi-nshdsacasa-m
  • molecular-weight:
    • 400.385

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality