Difference between revisions of "CPD-14875"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3041 == * common-name: ** isoliquiritigenin * smiles: ** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2) * inchi-key: ** dxdrhhkmwqzjht...") |
(Created page with "Category:metabolite == Metabolite CPD0-2354 == * common-name: ** a trna precursor with a 5' extension == Reaction(s) known to consume the compound == * RXN0-6480 == Re...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2354 == |
* common-name: | * common-name: | ||
− | ** | + | ** a trna precursor with a 5' extension |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-6480]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-4222]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a trna precursor with a 5' extension}} |
− | |||
− |
Revision as of 18:59, 14 January 2021
Contents
Metabolite CPD0-2354
- common-name:
- a trna precursor with a 5' extension