Difference between revisions of "CPD-14875"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2354 == * common-name: ** a trna precursor with a 5' extension == Reaction(s) known to consume the compound == * RXN0-6480 == Re...") |
(Created page with "Category:metabolite == Metabolite CPD-14875 == * common-name: ** grixazone b * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3))) * inchi...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14875 == |
* common-name: | * common-name: | ||
− | ** | + | ** grixazone b |
+ | * smiles: | ||
+ | ** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3))) | ||
+ | * inchi-key: | ||
+ | ** kupqduioulxtjz-jtqlqieisa-l | ||
+ | * molecular-weight: | ||
+ | ** 415.377 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15414]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=grixazone b}} |
+ | {{#set: inchi-key=inchikey=kupqduioulxtjz-jtqlqieisa-l}} | ||
+ | {{#set: molecular-weight=415.377}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-14875
- common-name:
- grixazone b
- smiles:
- cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3)))
- inchi-key:
- kupqduioulxtjz-jtqlqieisa-l
- molecular-weight:
- 415.377