Difference between revisions of "CPD-14875"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREODEHYD-RXN THREODEHYD-RXN] == * direction: ** left-to-right * common-name: ** threonine dehydro...")
(Created page with "Category:metabolite == Metabolite ACETOACETYL-COA == * common-name: ** acetoacetyl-coa * smiles: ** cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREODEHYD-RXN THREODEHYD-RXN] ==
+
== Metabolite ACETOACETYL-COA ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** threonine dehydrogenase
+
** acetoacetyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.103 ec-1.1.1.103]
+
** cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NAD]][c] '''+''' 1 [[THR]][c] '''=>''' 1 [[AMINO-OXOBUT]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
+
** ojfdkhtzouzbos-citakdkdsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09862]]
+
** 847.577
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
−
== Pathway(s) ==
+
* [[ACACT1h]]
−
* [[PWY-7378]], aminopropanol phosphate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7378 PWY-7378]
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
* [[HACD1h]]
−
* [[THRDLCTCAT-PWY]], L-threonine degradation III (to methylglyoxal): [http://metacyc.org/META/NEW-IMAGE?object=THRDLCTCAT-PWY THRDLCTCAT-PWY]
+
* [[HBCO_LPAREN_nadp_RPAREN_]]
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
* [[HBCO_LPAREN_nadp_RPAREN_m]]
−
* [[THREONINE-DEG2-PWY]], L-threonine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=THREONINE-DEG2-PWY THREONINE-DEG2-PWY]
+
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-11662]]
−
== Reconstruction information  ==
+
* [[RXN-5901]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
* [[ACACT]]
−
* RHEA:
+
* [[ACACT1h]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13162 13162]
+
* [[ACETOACETATE--COA-LIGASE-RXN]]
−
* LIGAND-RXN:
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01465 R01465]
+
* [[HACD1h]]
−
* UNIPROT:
+
* [[HBCO]]
−
** [http://www.uniprot.org/uniprot/O31776 O31776]
+
* [[HBCO_LPAREN_nadp_RPAREN_]]
−
** [http://www.uniprot.org/uniprot/P07913 P07913]
+
* [[HBCO_LPAREN_nadp_RPAREN_m]]
−
** [http://www.uniprot.org/uniprot/Q9UYX0 Q9UYX0]
+
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
−
** [http://www.uniprot.org/uniprot/O34268 O34268]
+
* [[RXN-11662]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=threonine dehydrogenase}}
+
{{#set: common-name=acetoacetyl-coa}}
−
{{#set: ec-number=ec-1.1.1.103}}
+
{{#set: inchi-key=inchikey=ojfdkhtzouzbos-citakdkdsa-j}}
−
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=847.577}}
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite ACETOACETYL-COA

  • common-name:
    • acetoacetyl-coa
  • smiles:
    • cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ojfdkhtzouzbos-citakdkdsa-j
  • molecular-weight:
    • 847.577

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-14875&oldid=48448"