Difference between revisions of "CPD-14894"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCEROPHOSPHOGLYCEROL == * common-name: ** glycerophosphoglycerol * smiles: ** c(c(cop(occ(co)o)([o-])=o)o)o * inchi-key: ** llcsxhmjulh...") |
(Created page with "Category:metabolite == Metabolite Cyclic-Phosphate-Terminated-RNAs == * common-name: ** an [rna]-3'-ribunucleoside-2',3'-cyclophosphate == Reaction(s) known to consume the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Cyclic-Phosphate-Terminated-RNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an [rna]-3'-ribunucleoside-2',3'-cyclophosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RNA-3-PHOSPHATE-CYCLASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an [rna]-3'-ribunucleoside-2',3'-cyclophosphate}} |
| − | |||
| − | |||
Revision as of 11:13, 15 January 2021
Contents
Metabolite Cyclic-Phosphate-Terminated-RNAs
- common-name:
- an [rna]-3'-ribunucleoside-2',3'-cyclophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an [rna]-3'-ribunucleoside-2',3'-cyclophosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
