Difference between revisions of "CPD-14894"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCEROPHOSPHOGLYCEROL == * common-name: ** glycerophosphoglycerol * smiles: ** c(c(cop(occ(co)o)([o-])=o)o)o * inchi-key: ** llcsxhmjulh...") |
(Created page with "Category:metabolite == Metabolite CPD-14894 == * common-name: ** ergosta-5,7-dienol * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inc...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14894 == |
* common-name: | * common-name: | ||
| − | ** | + | ** ergosta-5,7-dienol |
* smiles: | * smiles: | ||
| − | ** c(c( | + | ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zkqrgsxitbhhpc-vvqhazrasa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 398.671 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13883]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ergosta-5,7-dienol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zkqrgsxitbhhpc-vvqhazrasa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=398.671}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-14894
- common-name:
- ergosta-5,7-dienol
- smiles:
- cc(c)c(c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- zkqrgsxitbhhpc-vvqhazrasa-n
- molecular-weight:
- 398.671
