Difference between revisions of "CPD-14894"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11676 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ATPASE-RXN ** Category...") |
(Created page with "Category:metabolite == Metabolite CPD-17382 == * common-name: ** (3r)-hydroxy-tetracosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-17382 == |
| − | + | * common-name: | |
| − | * | + | ** (3r)-hydroxy-tetracosapentaenoyl-coa |
| − | == | + | * smiles: |
| − | + | ** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | |
| − | + | * inchi-key: | |
| − | + | ** drqaurckckdinz-kpyxopptsa-j | |
| − | + | * molecular-weight: | |
| − | * | + | ** 1120.05 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | ** | + | * [[RXN-16130]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-16129]] | |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=(3r)-hydroxy-tetracosapentaenoyl-coa}} |
| − | * [[ | + | {{#set: inchi-key=inchikey=drqaurckckdinz-kpyxopptsa-j}} |
| − | + | {{#set: molecular-weight=1120.05}} | |
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-17382
- common-name:
- (3r)-hydroxy-tetracosapentaenoyl-coa
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- drqaurckckdinz-kpyxopptsa-j
- molecular-weight:
- 1120.05
