Difference between revisions of "CPD-14900"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17919 RXN-17919] == * direction: ** left-to-right * common-name: ** dna ligase (atp) == Reactio...")
(Created page with "Category:metabolite == Metabolite CPD-7496 == * common-name: ** prolycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c * inchi-key:...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17919 RXN-17919] ==
+
== Metabolite CPD-7496 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** dna ligase (atp)
+
** prolycopene
−
== Reaction formula ==
+
* smiles:
−
* 1 [[3-Hydroxy-Terminated-DNAs]][c] '''+''' 1 [[A-5-prime-PP-5-prime-DNA]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[DNA-N]][c] '''+''' 1 [[PROTON]][c]
+
** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ15543]]
+
** oaijszizwzsqbc-byunhuqqsa-n
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 536.882
−
* Gene: [[SJ13521]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-8042]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ19344]]
+
* [[RXN-11357]]
−
** Category: [[annotation]]
+
* [[RXN-12242]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ16080]]
+
{{#set: common-name=prolycopene}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=oaijszizwzsqbc-byunhuqqsa-n}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=536.882}}
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=dna ligase (atp)}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-7496

  • common-name:
    • prolycopene
  • smiles:
    • cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c
  • inchi-key:
    • oaijszizwzsqbc-byunhuqqsa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-14900&oldid=47358"