Difference between revisions of "CPD-14901"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROPTERIN-CH2OH-PP == * common-name: ** (7,8-dihydropterin-6-yl)methyl diphosphate * smiles: ** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=n...")
(Created page with "Category:metabolite == Metabolite CPD-14901 == * common-name: ** poriferst-7-enol * smiles: ** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * in...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDROPTERIN-CH2OH-PP ==
+
== Metabolite CPD-14901 ==
 
* common-name:
 
* common-name:
** (7,8-dihydropterin-6-yl)methyl diphosphate
+
** poriferst-7-enol
 
* smiles:
 
* smiles:
** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
+
** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** fcqgjglsowzzon-uhfffaoysa-k
+
** yskvbpgqyrauqo-xcfyoidpsa-n
 
* molecular-weight:
 
* molecular-weight:
** 352.116
+
** 414.713
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[H2PTEROATESYNTH-RXN]]
+
* [[RXN-13892]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(7,8-dihydropterin-6-yl)methyl diphosphate}}
+
{{#set: common-name=poriferst-7-enol}}
{{#set: inchi-key=inchikey=fcqgjglsowzzon-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=yskvbpgqyrauqo-xcfyoidpsa-n}}
{{#set: molecular-weight=352.116}}
+
{{#set: molecular-weight=414.713}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14901

  • common-name:
    • poriferst-7-enol
  • smiles:
    • ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • yskvbpgqyrauqo-xcfyoidpsa-n
  • molecular-weight:
    • 414.713

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality