Difference between revisions of "CPD-14901"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14425 == * common-name: ** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)...")
(Created page with "Category:metabolite == Metabolite Triacylglycerides == * common-name: ** a triglyceride == Reaction(s) known to consume the compound == * TRIACYLGLYCEROL-LIPASE-RXN ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14425 ==
+
== Metabolite Triacylglycerides ==
 
* common-name:
 
* common-name:
** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa
+
** a triglyceride
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** hgvxutaezaltig-hkhrklhhsa-j
 
* molecular-weight:
 
** 1073.981
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13444]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa}}
+
{{#set: common-name=a triglyceride}}
{{#set: inchi-key=inchikey=hgvxutaezaltig-hkhrklhhsa-j}}
 
{{#set: molecular-weight=1073.981}}
 

Revision as of 13:10, 14 January 2021

Metabolite Triacylglycerides

  • common-name:
    • a triglyceride

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality