Difference between revisions of "CPD-14916"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16202 == * transcription-direction: ** negative * right-end-position: ** 14105 * left-end-position: ** 12525 * centisome-position: ** 4.376142...")
(Created page with "Category:metabolite == Metabolite CPD-14916 == * common-name: ** (r)-3-hydroxyoctanoyl-coa * smiles: ** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ16202 ==
+
== Metabolite CPD-14916 ==
* transcription-direction:
+
* common-name:
** negative
+
** (r)-3-hydroxyoctanoyl-coa
* right-end-position:
+
* smiles:
** 14105
+
** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
* left-end-position:
+
* inchi-key:
** 12525
+
** atvgtmkwkducms-jwbywsjjsa-j
* centisome-position:
+
* molecular-weight:
** 4.376142   
+
** 905.7
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
== Reaction(s) associated ==
+
* [[RXN-14275]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14276]]
{{#set: transcription-direction=negative}}
+
== Reaction(s) of unknown directionality ==
{{#set: right-end-position=14105}}
+
{{#set: common-name=(r)-3-hydroxyoctanoyl-coa}}
{{#set: left-end-position=12525}}
+
{{#set: inchi-key=inchikey=atvgtmkwkducms-jwbywsjjsa-j}}
{{#set: centisome-position=4.376142    }}
+
{{#set: molecular-weight=905.7}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14916

  • common-name:
    • (r)-3-hydroxyoctanoyl-coa
  • smiles:
    • cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • atvgtmkwkducms-jwbywsjjsa-j
  • molecular-weight:
    • 905.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality