Difference between revisions of "CPD-14916"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22393 == * transcription-direction: ** positive * right-end-position: ** 14425 * left-end-position: ** 8806 * centisome-position: ** 4.966919 =...")
(Created page with "Category:metabolite == Metabolite CPD-14916 == * common-name: ** (r)-3-hydroxyoctanoyl-coa * smiles: ** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ22393 ==
+
== Metabolite CPD-14916 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (r)-3-hydroxyoctanoyl-coa
−
* right-end-position:
+
* smiles:
−
** 14425
+
** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
−
* left-end-position:
+
* inchi-key:
−
** 8806
+
** atvgtmkwkducms-jwbywsjjsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 4.966919   
+
** 905.7
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
−
== Reaction(s) associated ==
+
* [[RXN-14275]]
−
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14276]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=(r)-3-hydroxyoctanoyl-coa}}
−
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=atvgtmkwkducms-jwbywsjjsa-j}}
−
* [[PWY-7511]]
+
{{#set: molecular-weight=905.7}}
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=14425}}
 
−
{{#set: left-end-position=8806}}
 
−
{{#set: centisome-position=4.966919    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14916

  • common-name:
    • (r)-3-hydroxyoctanoyl-coa
  • smiles:
    • cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • atvgtmkwkducms-jwbywsjjsa-j
  • molecular-weight:
    • 905.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-14916&oldid=137961"