Difference between revisions of "CPD-14916"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Lipid-3E-hexadecenoate == * common-name: ** a [glycerolipid]-(3e)-hexadec-3-enoate == Reaction(s) known to consume the compound == == Rea...")
(Created page with "Category:metabolite == Metabolite CPD-14916 == * common-name: ** (r)-3-hydroxyoctanoyl-coa * smiles: ** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Lipid-3E-hexadecenoate ==
+
== Metabolite CPD-14916 ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-(3e)-hexadec-3-enoate
+
** (r)-3-hydroxyoctanoyl-coa
 +
* smiles:
 +
** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
 +
* inchi-key:
 +
** atvgtmkwkducms-jwbywsjjsa-j
 +
* molecular-weight:
 +
** 905.7
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
 +
* [[RXN-14275]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16053]]
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
 +
* [[RXN-14276]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-(3e)-hexadec-3-enoate}}
+
{{#set: common-name=(r)-3-hydroxyoctanoyl-coa}}
 +
{{#set: inchi-key=inchikey=atvgtmkwkducms-jwbywsjjsa-j}}
 +
{{#set: molecular-weight=905.7}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14916

  • common-name:
    • (r)-3-hydroxyoctanoyl-coa
  • smiles:
    • cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • atvgtmkwkducms-jwbywsjjsa-j
  • molecular-weight:
    • 905.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality