Difference between revisions of "CPD-14916"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DTDP-RHAMNOSE == * common-name: ** dtdp-β-l-rhamnose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c...")
(Created page with "Category:metabolite == Metabolite Lipid-3E-hexadecenoate == * common-name: ** a [glycerolipid]-(3e)-hexadec-3-enoate == Reaction(s) known to consume the compound == == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DTDP-RHAMNOSE ==
+
== Metabolite Lipid-3E-hexadecenoate ==
 
* common-name:
 
* common-name:
** dtdp-β-l-rhamnose
+
** a [glycerolipid]-(3e)-hexadec-3-enoate
* smiles:
 
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
 
* inchi-key:
 
** zosqfdvxnqfkby-cgaxjhmrsa-l
 
* molecular-weight:
 
** 546.317
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DTDPDEHYRHAMREDUCT-RXN]]
+
* [[RXN-16053]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtdp-β-l-rhamnose}}
+
{{#set: common-name=a [glycerolipid]-(3e)-hexadec-3-enoate}}
{{#set: inchi-key=inchikey=zosqfdvxnqfkby-cgaxjhmrsa-l}}
 
{{#set: molecular-weight=546.317}}
 

Revision as of 14:56, 5 January 2021

Metabolite Lipid-3E-hexadecenoate

  • common-name:
    • a [glycerolipid]-(3e)-hexadec-3-enoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-(3e)-hexadec-3-enoate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.