Difference between revisions of "CPD-14925"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Hyaluronan-glucuronate-terminal == * common-name: ** β-d-glucuronosyl-[hyaluronan] == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14925 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3z)-dec-3-enoyl-coa |
| + | * smiles: | ||
| + | ** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | ||
| + | * inchi-key: | ||
| + | ** cqgvnmqhzqjnii-uusbzyposa-j | ||
| + | * molecular-weight: | ||
| + | ** 915.738 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-17799]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3z)-dec-3-enoyl-coa}} |
| + | {{#set: inchi-key=inchikey=cqgvnmqhzqjnii-uusbzyposa-j}} | ||
| + | {{#set: molecular-weight=915.738}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-14925
- common-name:
- (3z)-dec-3-enoyl-coa
- smiles:
- ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- cqgvnmqhzqjnii-uusbzyposa-j
- molecular-weight:
- 915.738
