Difference between revisions of "CPD-14925"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PYRAZINAMIDE == * common-name: ** pyrazinamide * smiles: ** c1(n=cc=nc=1c(=o)n) * inchi-key: ** ipehbumcgvemrf-uhfffaoysa-n * molecular-w...") |
(Created page with "Category:metabolite == Metabolite CPD-16475 == * common-name: ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine * smiles: ** c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-16475 == |
* common-name: | * common-name: | ||
− | ** | + | ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine |
* smiles: | * smiles: | ||
− | ** | + | ** cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hbbozfuqjdyasd-qgtnpelvsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 529.494 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15268]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-15268]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hbbozfuqjdyasd-qgtnpelvsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=529.494}} |
Revision as of 14:59, 5 January 2021
Contents
Metabolite CPD-16475
- common-name:
- β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine
- smiles:
- cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3)
- inchi-key:
- hbbozfuqjdyasd-qgtnpelvsa-n
- molecular-weight:
- 529.494
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.