Difference between revisions of "CPD-14926"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-PROPIONYL-COA == * common-name: ** 3-hydroxypropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(...")
(Created page with "Category:metabolite == Metabolite CPD-14926 == * common-name: ** phytenal * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o * inchi-key: ** rafzysuicbqabu-pyddkjgssa-n * mol...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-PROPIONYL-COA ==
+
== Metabolite CPD-14926 ==
 
* common-name:
 
* common-name:
** 3-hydroxypropanoyl-coa
+
** phytenal
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o
 
* inchi-key:
 
* inchi-key:
** berbfzcusmqabm-iexphmlfsa-j
+
** rafzysuicbqabu-pyddkjgssa-n
 
* molecular-weight:
 
* molecular-weight:
** 835.566
+
** 294.52
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HICH]]
+
* [[RXN66-479]]
* [[RXN-6383]]
 
* [[RXN-6384]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6383]]
+
* [[RXN66-478]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxypropanoyl-coa}}
+
{{#set: common-name=phytenal}}
{{#set: inchi-key=inchikey=berbfzcusmqabm-iexphmlfsa-j}}
+
{{#set: inchi-key=inchikey=rafzysuicbqabu-pyddkjgssa-n}}
{{#set: molecular-weight=835.566}}
+
{{#set: molecular-weight=294.52}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-14926

  • common-name:
    • phytenal
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o
  • inchi-key:
    • rafzysuicbqabu-pyddkjgssa-n
  • molecular-weight:
    • 294.52

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality