Difference between revisions of "CPD-14926"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15125 == * common-name: ** 2,4-dihydroxyhept-2-enedioate * smiles: ** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-] * inchi-key: ** apnidhdqyiszae...")
(Created page with "Category:metabolite == Metabolite CPD-14926 == * common-name: ** phytenal * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o * inchi-key: ** rafzysuicbqabu-pyddkjgssa-n * mol...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15125 ==
+
== Metabolite CPD-14926 ==
 
* common-name:
 
* common-name:
** 2,4-dihydroxyhept-2-enedioate
+
** phytenal
 
* smiles:
 
* smiles:
** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
+
** cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o
 
* inchi-key:
 
* inchi-key:
** apnidhdqyiszae-hyxafxhysa-l
+
** rafzysuicbqabu-pyddkjgssa-n
 
* molecular-weight:
 
* molecular-weight:
** 188.137
+
** 294.52
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14146]]
+
* [[RXN66-479]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14146]]
+
* [[RXN66-478]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,4-dihydroxyhept-2-enedioate}}
+
{{#set: common-name=phytenal}}
{{#set: inchi-key=inchikey=apnidhdqyiszae-hyxafxhysa-l}}
+
{{#set: inchi-key=inchikey=rafzysuicbqabu-pyddkjgssa-n}}
{{#set: molecular-weight=188.137}}
+
{{#set: molecular-weight=294.52}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-14926

  • common-name:
    • phytenal
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o
  • inchi-key:
    • rafzysuicbqabu-pyddkjgssa-n
  • molecular-weight:
    • 294.52

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality