Difference between revisions of "CPD-14927"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-VAL-tRNAs == * common-name: ** an l-valyl-[trnaval] == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
(Created page with "Category:metabolite == Metabolite CPD-14927 == * common-name: ** phytenate * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-] * inchi-key: ** wdwbnnbrpveeod-pfxvradusa-m *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14927 == |
* common-name: | * common-name: | ||
| − | ** | + | ** phytenate |
| + | * smiles: | ||
| + | ** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** wdwbnnbrpveeod-pfxvradusa-m | ||
| + | * molecular-weight: | ||
| + | ** 309.511 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN66-480]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-479]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phytenate}} |
| + | {{#set: inchi-key=inchikey=wdwbnnbrpveeod-pfxvradusa-m}} | ||
| + | {{#set: molecular-weight=309.511}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-14927
- common-name:
- phytenate
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
- inchi-key:
- wdwbnnbrpveeod-pfxvradusa-m
- molecular-weight:
- 309.511
