Difference between revisions of "CPD-14927"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15688 == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * smiles: ** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...") |
(Created page with "Category:metabolite == Metabolite CPD-14927 == * common-name: ** phytenate * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-] * inchi-key: ** wdwbnnbrpveeod-pfxvradusa-m *...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14927 == |
* common-name: | * common-name: | ||
| − | ** | + | ** phytenate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wdwbnnbrpveeod-pfxvradusa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 309.511 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN66-480]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-479]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phytenate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wdwbnnbrpveeod-pfxvradusa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=309.511}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-14927
- common-name:
- phytenate
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
- inchi-key:
- wdwbnnbrpveeod-pfxvradusa-m
- molecular-weight:
- 309.511
