Difference between revisions of "CPD-14927"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15688 == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * smiles: ** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite Very-Long-Chain-Trans-23-Dehydroacyl-CoA == * common-name: ** a very-long-chain trans-2,3-dehydroacyl-coa == Reaction(s) known to consume...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15688 ==
+
== Metabolite Very-Long-Chain-Trans-23-Dehydroacyl-CoA ==
 
* common-name:
 
* common-name:
** (3z,5e)-dodeca-3,5-dienoyl-coa
+
** a very-long-chain trans-2,3-dehydroacyl-coa
* smiles:
 
** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** arquzfjqpywssl-nbluimthsa-j
 
* molecular-weight:
 
** 941.776
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14799]]
+
* [[RXN-11750]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z,5e)-dodeca-3,5-dienoyl-coa}}
+
{{#set: common-name=a very-long-chain trans-2,3-dehydroacyl-coa}}
{{#set: inchi-key=inchikey=arquzfjqpywssl-nbluimthsa-j}}
 
{{#set: molecular-weight=941.776}}
 

Revision as of 14:58, 5 January 2021

Metabolite Very-Long-Chain-Trans-23-Dehydroacyl-CoA

  • common-name:
    • a very-long-chain trans-2,3-dehydroacyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality