Difference between revisions of "CPD-14928"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Persulfurated-L-cysteine-desulfurases == * common-name: ** an s-sulfanyl-[l-cysteine desulfurase] == Reaction(s) known to consume the com...")
(Created page with "Category:metabolite == Metabolite CPD-14928 == * common-name: ** phytenoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Persulfurated-L-cysteine-desulfurases ==
+
== Metabolite CPD-14928 ==
 
* common-name:
 
* common-name:
** an s-sulfanyl-[l-cysteine desulfurase]
+
** phytenoyl-coa
 +
* smiles:
 +
** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** nyzpdfuazacyot-peaqseffsa-j
 +
* molecular-weight:
 +
** 1056.006
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-482]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15881]]
+
* [[RXN66-480]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an s-sulfanyl-[l-cysteine desulfurase]}}
+
{{#set: common-name=phytenoyl-coa}}
 +
{{#set: inchi-key=inchikey=nyzpdfuazacyot-peaqseffsa-j}}
 +
{{#set: molecular-weight=1056.006}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-14928

  • common-name:
    • phytenoyl-coa
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nyzpdfuazacyot-peaqseffsa-j
  • molecular-weight:
    • 1056.006

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality