Difference between revisions of "CPD-14928"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-GLU == * common-name: ** n-acetyl-l-glutamate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** rfmmmvdnipukgg-yfkpbyrvs...")
(Created page with "Category:metabolite == Metabolite CPD-14928 == * common-name: ** phytenoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETYL-GLU ==
+
== Metabolite CPD-14928 ==
 
* common-name:
 
* common-name:
** n-acetyl-l-glutamate
+
** phytenoyl-coa
 
* smiles:
 
* smiles:
** cc(=o)nc(c([o-])=o)ccc(=o)[o-]
+
** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** rfmmmvdnipukgg-yfkpbyrvsa-l
+
** nyzpdfuazacyot-peaqseffsa-j
 
* molecular-weight:
 
* molecular-weight:
** 187.152
+
** 1056.006
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[RXN66-482]]
* [[AGK]]
 
* [[N-ACETYLTRANSFER-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[RXN66-480]]
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 
* [[N-ACETYLTRANSFER-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-glutamate}}
+
{{#set: common-name=phytenoyl-coa}}
{{#set: inchi-key=inchikey=rfmmmvdnipukgg-yfkpbyrvsa-l}}
+
{{#set: inchi-key=inchikey=nyzpdfuazacyot-peaqseffsa-j}}
{{#set: molecular-weight=187.152}}
+
{{#set: molecular-weight=1056.006}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-14928

  • common-name:
    • phytenoyl-coa
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nyzpdfuazacyot-peaqseffsa-j
  • molecular-weight:
    • 1056.006

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality