Difference between revisions of "CPD-14928"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3618 == * common-name: ** 2-oxovalerate * smiles: ** cccc(=o)c(=o)[o-] * inchi-key: ** kdvfrmmrzocfls-uhfffaoysa-m * molecular-weight...") |
(Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15436 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (5z)-tetradecenoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mrvdzohjmltlhj-stfckwfxsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 971.845 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14576]] | ||
| + | * [[RXN-17783]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17782]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(5z)-tetradecenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=971.845}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD-15436
- common-name:
- (5z)-tetradecenoyl-coa
- smiles:
- ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- mrvdzohjmltlhj-stfckwfxsa-j
- molecular-weight:
- 971.845
