Difference between revisions of "CPD-14928"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
(Created page with "Category:metabolite == Metabolite 2-Prime-Ribonucleoside-Monophosphates == * common-name: ** a ribonucleoside 2'-phosphate == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15436 ==
+
== Metabolite 2-Prime-Ribonucleoside-Monophosphates ==
 
* common-name:
 
* common-name:
** (5z)-tetradecenoyl-coa
+
** a ribonucleoside 2'-phosphate
* smiles:
 
** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** mrvdzohjmltlhj-stfckwfxsa-j
 
* molecular-weight:
 
** 971.845
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14576]]
+
* [[RXN-17948]]
* [[RXN-17783]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17782]]
+
* [[3.1.4.37-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z)-tetradecenoyl-coa}}
+
{{#set: common-name=a ribonucleoside 2'-phosphate}}
{{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}}
 
{{#set: molecular-weight=971.845}}
 

Revision as of 18:54, 14 January 2021

Metabolite 2-Prime-Ribonucleoside-Monophosphates

  • common-name:
    • a ribonucleoside 2'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality