Difference between revisions of "CPD-14931"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == * common-name: ** sn-glycero-3-phosphoethanolamine * smiles: ** c(op([o-])(occ(co)o)=o)c[n+] * inch...")
(Created page with "Category:metabolite == Metabolite CPD-14931 == * common-name: ** a 10-formyltetrahydrofolate-4a-carbinolamine == Reaction(s) known to consume the compound == * RXN-13908...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE ==
+
== Metabolite CPD-14931 ==
 
* common-name:
 
* common-name:
** sn-glycero-3-phosphoethanolamine
+
** a 10-formyltetrahydrofolate-4a-carbinolamine
* smiles:
 
** c(op([o-])(occ(co)o)=o)c[n+]
 
* inchi-key:
 
** jznwscpgtdbmew-rxmqykedsa-n
 
* molecular-weight:
 
** 215.142
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14160]]
+
* [[RXN-13908]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15035]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sn-glycero-3-phosphoethanolamine}}
+
{{#set: common-name=a 10-formyltetrahydrofolate-4a-carbinolamine}}
{{#set: inchi-key=inchikey=jznwscpgtdbmew-rxmqykedsa-n}}
 
{{#set: molecular-weight=215.142}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-14931

  • common-name:
    • a 10-formyltetrahydrofolate-4a-carbinolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality