Difference between revisions of "CPD-14931"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-cysteine-sulfonate == * common-name: ** an n-terminal 3-sulfo-l-alanyl-[protein] == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == * common-name: ** sn-glycero-3-phosphoethanolamine * smiles: ** c(op([o-])(occ(co)o)=o)c[n+] * inch...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** sn-glycero-3-phosphoethanolamine |
| + | * smiles: | ||
| + | ** c(op([o-])(occ(co)o)=o)c[n+] | ||
| + | * inchi-key: | ||
| + | ** jznwscpgtdbmew-rxmqykedsa-n | ||
| + | * molecular-weight: | ||
| + | ** 215.142 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14160]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15035]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sn-glycero-3-phosphoethanolamine}} |
| + | {{#set: inchi-key=inchikey=jznwscpgtdbmew-rxmqykedsa-n}} | ||
| + | {{#set: molecular-weight=215.142}} | ||
Revision as of 13:07, 14 January 2021
Contents
Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE
- common-name:
- sn-glycero-3-phosphoethanolamine
- smiles:
- c(op([o-])(occ(co)o)=o)c[n+]
- inchi-key:
- jznwscpgtdbmew-rxmqykedsa-n
- molecular-weight:
- 215.142
