Difference between revisions of "CPD-14931"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == * common-name: ** sn-glycero-3-phosphoethanolamine * smiles: ** c(op([o-])(occ(co)o)=o)c[n+] * inch...") |
(Created page with "Category:metabolite == Metabolite CPD-14931 == * common-name: ** a 10-formyltetrahydrofolate-4a-carbinolamine == Reaction(s) known to consume the compound == * RXN-13908...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14931 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 10-formyltetrahydrofolate-4a-carbinolamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13908]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 10-formyltetrahydrofolate-4a-carbinolamine}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-14931
- common-name:
- a 10-formyltetrahydrofolate-4a-carbinolamine
