Difference between revisions of "CPD-14950"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite galactosylceramide-sulfate == * common-name: ** a galactosylceramide sulfate == Reaction(s) known to consume the compound == == Reaction(...") |
(Created page with "Category:metabolite == Metabolite CPD-9859 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9859 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol |
| + | * smiles: | ||
| + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** rohkdmwqxdhldy-hohoqcmasa-n | ||
| + | * molecular-weight: | ||
| + | ** 630.993 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9227]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol}} |
| + | {{#set: inchi-key=inchikey=rohkdmwqxdhldy-hohoqcmasa-n}} | ||
| + | {{#set: molecular-weight=630.993}} | ||
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-9859
- common-name:
- 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c
- inchi-key:
- rohkdmwqxdhldy-hohoqcmasa-n
- molecular-weight:
- 630.993
