|
|
| (7 intermediate revisions by 2 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRAISOM-RXN PRAISOM-RXN] == | + | == Metabolite CPD-15035 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** phosphoribosylanthranilate isomerase | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/5.3.1.24 ec-5.3.1.24] | + | ** cc(=o)nc2(c(oc1(oc(c(=o)[o-])=cc(o)c(os([o-])(=o)=o)1))c(o)c(co)oc(o)2) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[N-5-PHOSPHORIBOSYL-ANTHRANILATE]][c] '''=>''' 1 [[CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P]][c]
| + | ** zeucjyoqjtzlfj-rbcdgzsosa-l |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ17722]] | + | ** 457.362 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[RXN-14021]] |
| − | * Gene: [[SJ01083]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=zeucjyoqjtzlfj-rbcdgzsosa-l}} |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: molecular-weight=457.362}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[TRPSYN-PWY]], L-tryptophan biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] | |
| − | ** '''6''' reactions found over '''6''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21541 21541]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03509 R03509]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P16923 P16923]
| |
| − | ** [http://www.uniprot.org/uniprot/O67853 O67853]
| |
| − | ** [http://www.uniprot.org/uniprot/P12289 P12289]
| |
| − | ** [http://www.uniprot.org/uniprot/P42393 P42393]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PIF3 Q9PIF3]
| |
| − | ** [http://www.uniprot.org/uniprot/Q57893 Q57893]
| |
| − | ** [http://www.uniprot.org/uniprot/P20167 P20167]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JVD1 Q9JVD1]
| |
| − | ** [http://www.uniprot.org/uniprot/P00910 P00910]
| |
| − | ** [http://www.uniprot.org/uniprot/P00909 P00909]
| |
| − | ** [http://www.uniprot.org/uniprot/P00912 P00912]
| |
| − | ** [http://www.uniprot.org/uniprot/P13997 P13997]
| |
| − | ** [http://www.uniprot.org/uniprot/P50857 P50857]
| |
| − | ** [http://www.uniprot.org/uniprot/P27710 P27710]
| |
| − | ** [http://www.uniprot.org/uniprot/P17218 P17218]
| |
| − | ** [http://www.uniprot.org/uniprot/P00908 P00908]
| |
| − | ** [http://www.uniprot.org/uniprot/P18483 P18483]
| |
| − | ** [http://www.uniprot.org/uniprot/Q02002 Q02002]
| |
| − | ** [http://www.uniprot.org/uniprot/Q56320 Q56320]
| |
| − | ** [http://www.uniprot.org/uniprot/Q01128 Q01128]
| |
| − | ** [http://www.uniprot.org/uniprot/P74435 P74435]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9YGB1 Q9YGB1]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}} | |
| − | {{#set: common-name=phosphoribosylanthranilate isomerase}}
| |
| − | {{#set: ec-number=ec-5.3.1.24}}
| |
| − | {{#set: nb gene associated=2}}
| |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}} | |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
| |
