Difference between revisions of "CPD-15036"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1302 == * common-name: ** 5-methyltetrahydropteroyl tri-l-glutamate * smiles: ** cn1([ch](cnc2(n=c(nc(=o)c1=2)n))cnc3(=cc=c(c(=o)nc(c...") |
(Created page with "Category:metabolite == Metabolite CPD-15036 == * common-name: ** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate * smiles: ** c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-] * inchi-k...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15036 == |
* common-name: | * common-name: | ||
| − | ** 5- | + | ** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wfkzeqzrfipkif-ucorvyfpsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 254.168 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14021]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=5- | + | {{#set: common-name=5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wfkzeqzrfipkif-ucorvyfpsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=254.168}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-15036
- common-name:
- 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate
- smiles:
- c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-]
- inchi-key:
- wfkzeqzrfipkif-ucorvyfpsa-l
- molecular-weight:
- 254.168
