Difference between revisions of "CPD-15056"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LEUKOTRIENE-C4 == * common-name: ** leukotriene-c4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc(...")
(Created page with "Category:metabolite == Metabolite CPD-15056 == * common-name: ** (2z)-2-aminobut-2-enoate * smiles: ** cc=c(n)c(=o)[o-] * inchi-key: ** pawsvpvnixfkos-ihwypqmzsa-m * molec...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LEUKOTRIENE-C4 ==
+
== Metabolite CPD-15056 ==
 
* common-name:
 
* common-name:
** leukotriene-c4
+
** (2z)-2-aminobut-2-enoate
 
* smiles:
 
* smiles:
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
+
** cc=c(n)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** gwnvdxqdilpjig-nxolixfesa-l
+
** pawsvpvnixfkos-ihwypqmzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 623.76
+
** 100.097
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-336]]
+
* [[RXN-15122]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
+
* [[RXN-14048]]
 +
* [[RXN-14049]]
 +
* [[RXN-15122]]
 +
* [[RXN-15148]]
 +
* [[RXN-15149]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=leukotriene-c4}}
+
{{#set: common-name=(2z)-2-aminobut-2-enoate}}
{{#set: inchi-key=inchikey=gwnvdxqdilpjig-nxolixfesa-l}}
+
{{#set: inchi-key=inchikey=pawsvpvnixfkos-ihwypqmzsa-m}}
{{#set: molecular-weight=623.76}}
+
{{#set: molecular-weight=100.097}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15056

  • common-name:
    • (2z)-2-aminobut-2-enoate
  • smiles:
    • cc=c(n)c(=o)[o-]
  • inchi-key:
    • pawsvpvnixfkos-ihwypqmzsa-m
  • molecular-weight:
    • 100.097

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality