Difference between revisions of "CPD-15104"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...") |
(Created page with "Category:metabolite == Metabolite CPD-15104 == * common-name: ** (r)-3-hydroxy-3-methyl-2-oxopentanoate * smiles: ** ccc(o)(c)c(=o)c(=o)[o-] * inchi-key: ** yjvowrawfxresp...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15104 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-3-hydroxy-3-methyl-2-oxopentanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(o)(c)c(=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yjvowrawfxresp-zcfiwibfsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 145.135 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[KARI_LPAREN_23dhmp_RPAREN_]] |
| + | * [[RXN-14106]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14106]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-3-hydroxy-3-methyl-2-oxopentanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yjvowrawfxresp-zcfiwibfsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=145.135}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15104
- common-name:
- (r)-3-hydroxy-3-methyl-2-oxopentanoate
- smiles:
- ccc(o)(c)c(=o)c(=o)[o-]
- inchi-key:
- yjvowrawfxresp-zcfiwibfsa-m
- molecular-weight:
- 145.135
