Difference between revisions of "CPD-15104"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...") |
(Created page with "Category:metabolite == Metabolite Rubisco-trimethylated-lysine == * common-name: ** a [ribulose-1,5-bisphosphate-carboxylase]-n6,n6,n6-trimethyl-l-lysine == Reaction(s) kn...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Rubisco-trimethylated-lysine == |
* common-name: | * common-name: | ||
− | ** 1- | + | ** a [ribulose-1,5-bisphosphate-carboxylase]-n6,n6,n6-trimethyl-l-lysine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[2.1.1.127-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=1- | + | {{#set: common-name=a [ribulose-1,5-bisphosphate-carboxylase]-n6,n6,n6-trimethyl-l-lysine}} |
− | |||
− |
Revision as of 14:56, 5 January 2021
Contents
Metabolite Rubisco-trimethylated-lysine
- common-name:
- a [ribulose-1,5-bisphosphate-carboxylase]-n6,n6,n6-trimethyl-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [ribulose-1,5-bisphosphate-carboxylase]-n6,n6,n6-trimethyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.