Difference between revisions of "CPD-15125"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOVALERYL-COA == * common-name: ** 3-hydroxyisovaleryl-coa * smiles: ** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=...")
(Created page with "Category:metabolite == Metabolite CPD-15125 == * common-name: ** 2,4-dihydroxyhept-2-enedioate * smiles: ** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-] * inchi-key: ** apnidhdqyiszae...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-ISOVALERYL-COA ==
+
== Metabolite CPD-15125 ==
 
* common-name:
 
* common-name:
** 3-hydroxyisovaleryl-coa
+
** 2,4-dihydroxyhept-2-enedioate
 
* smiles:
 
* smiles:
** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
+
** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** pevzkilcbdeobt-uhfffaoysa-j
+
** apnidhdqyiszae-hyxafxhysa-l
 
* molecular-weight:
 
* molecular-weight:
** 863.619
+
** 188.137
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[RXN-14146]]
* [[RXN-14266]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[RXN-14146]]
* [[RXN-14266]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxyisovaleryl-coa}}
+
{{#set: common-name=2,4-dihydroxyhept-2-enedioate}}
{{#set: inchi-key=inchikey=pevzkilcbdeobt-uhfffaoysa-j}}
+
{{#set: inchi-key=inchikey=apnidhdqyiszae-hyxafxhysa-l}}
{{#set: molecular-weight=863.619}}
+
{{#set: molecular-weight=188.137}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-15125

  • common-name:
    • 2,4-dihydroxyhept-2-enedioate
  • smiles:
    • c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
  • inchi-key:
    • apnidhdqyiszae-hyxafxhysa-l
  • molecular-weight:
    • 188.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality