Difference between revisions of "CPD-15152"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed-BIOTIN TransportSeed-BIOTIN] == * direction: ** left-to-right == Reaction formula ==...") |
(Created page with "Category:metabolite == Metabolite CPD-15152 == * common-name: ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15152 == |
− | * | + | * common-name: |
− | ** | + | ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone |
− | == | + | * smiles: |
− | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1) | |
− | == | + | * inchi-key: |
− | == | + | ** aftbilpwmusgin-mycgwmctsa-n |
− | == | + | * molecular-weight: |
− | * | + | ** 683.068 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14177]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=aftbilpwmusgin-mycgwmctsa-n}} |
− | {{#set: | + | {{#set: molecular-weight=683.068}} |
− | {{#set: |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-15152
- common-name:
- 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
- inchi-key:
- aftbilpwmusgin-mycgwmctsa-n
- molecular-weight:
- 683.068