|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8668 RXN-8668] == | + | == Metabolite CPD-15153 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** protein-methionine-s-oxide reductase | + | ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone |
| − | ** peptide-methionine (s)-s-oxide reductase
| + | * smiles: |
| − | * ec-number: | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1) |
| − | ** [http://enzyme.expasy.org/EC/1.8.4.11 ec-1.8.4.11] | + | * inchi-key: |
| − | == Reaction formula == | + | ** flybtlrocqbhmr-kfsstaeesa-n |
| − | * 1 [[Protein-L-methionine-S-S-oxides]][c] '''+''' 1 [[Red-Thioredoxin]][c] '''=>''' 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[Protein-L-methionine]][c] '''+''' 1 [[WATER]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction == | + | ** 697.095 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ18862]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-14177]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ15414]]
| + | {{#set: common-name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=flybtlrocqbhmr-kfsstaeesa-n}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | {{#set: molecular-weight=697.095}} |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ13438]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ17262]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ20421]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ17035]]
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ03909]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ17041]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14219 14219]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R04120 R04120]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=protein-methionine-s-oxide reductase|peptide-methionine (s)-s-oxide reductase}} | |
| − | {{#set: ec-number=ec-1.8.4.11}}
| |
| − | {{#set: nb gene associated=8}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
| |
