Difference between revisions of "CPD-15153"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10068 RXN-10068] == * direction: ** reversible * common-name: ** isopentenyl phosphate kinase *...") |
(Created page with "Category:metabolite == Metabolite K-HEXANOYL-COA == * common-name: ** 3-oxohexanoyl-coa * smiles: ** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite K-HEXANOYL-COA == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxohexanoyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o |
| − | == | + | * inchi-key: |
| − | + | ** nfoyyxqavvywkv-hdrqghtbsa-j | |
| − | + | * molecular-weight: | |
| − | * | + | ** 875.63 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[HACD2h]] |
| − | == | + | * [[RXN-12570]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ACACT2h]] | |
| − | * [[ | + | * [[HACD2h]] |
| − | + | * [[RXN-12565]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=3-oxohexanoyl-coa}} |
| − | == | + | {{#set: inchi-key=inchikey=nfoyyxqavvywkv-hdrqghtbsa-j}} |
| − | + | {{#set: molecular-weight=875.63}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite K-HEXANOYL-COA
- common-name:
- 3-oxohexanoyl-coa
- smiles:
- cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
- inchi-key:
- nfoyyxqavvywkv-hdrqghtbsa-j
- molecular-weight:
- 875.63
