Difference between revisions of "CPD-15153"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RNASE-II-POLY-A-SUBSTRATE-MRNA == * common-name: ** rnase ii poly-a substrate mrna == Reaction(s) known to consume the compound == * RX...") |
(Created page with "Category:metabolite == Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE == * common-name: ** (r,s)-tetrahydrobenzylisoquinoline * smiles: ** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r,s)-tetrahydrobenzylisoquinoline |
| + | * smiles: | ||
| + | ** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3) | ||
| + | * inchi-key: | ||
| + | ** yrycifuzsumaay-uhfffaoysa-o | ||
| + | * molecular-weight: | ||
| + | ** 224.325 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.1.1.115-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r,s)-tetrahydrobenzylisoquinoline}} |
| + | {{#set: inchi-key=inchikey=yrycifuzsumaay-uhfffaoysa-o}} | ||
| + | {{#set: molecular-weight=224.325}} | ||
Revision as of 15:30, 5 January 2021
Contents
Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE
- common-name:
- (r,s)-tetrahydrobenzylisoquinoline
- smiles:
- c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3)
- inchi-key:
- yrycifuzsumaay-uhfffaoysa-o
- molecular-weight:
- 224.325
