Difference between revisions of "CPD-15153"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE == * common-name: ** (r,s)-tetrahydrobenzylisoquinoline * smiles: ** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))...")
(Created page with "Category:metabolite == Metabolite CPD-15153 == * common-name: ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE ==
+
== Metabolite CPD-15153 ==
 
* common-name:
 
* common-name:
** (r,s)-tetrahydrobenzylisoquinoline
+
** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
 
* smiles:
 
* smiles:
** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3)
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1)
 
* inchi-key:
 
* inchi-key:
** yrycifuzsumaay-uhfffaoysa-o
+
** flybtlrocqbhmr-kfsstaeesa-n
 
* molecular-weight:
 
* molecular-weight:
** 224.325
+
** 697.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.115-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14177]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r,s)-tetrahydrobenzylisoquinoline}}
+
{{#set: common-name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}}
{{#set: inchi-key=inchikey=yrycifuzsumaay-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=flybtlrocqbhmr-kfsstaeesa-n}}
{{#set: molecular-weight=224.325}}
+
{{#set: molecular-weight=697.095}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15153

  • common-name:
    • 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1)
  • inchi-key:
    • flybtlrocqbhmr-kfsstaeesa-n
  • molecular-weight:
    • 697.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality