Difference between revisions of "CPD-15172"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14706 == * common-name: ** 4-hydroxy-2-nonenal-[l-cys] conjugate * smiles: ** cccccc(o)c(cc=o)scc([n+])c(=o)[o-] * inchi-key: ** salp...")
(Created page with "Category:metabolite == Metabolite CPD-15172 == * common-name: ** 6,7-dehydrobaicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3))) * inchi-key: ** ls...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14706 ==
+
== Metabolite CPD-15172 ==
 
* common-name:
 
* common-name:
** 4-hydroxy-2-nonenal-[l-cys] conjugate
+
** 6,7-dehydrobaicalein
 
* smiles:
 
* smiles:
** cccccc(o)c(cc=o)scc([n+])c(=o)[o-]
+
** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3)))
 
* inchi-key:
 
* inchi-key:
** salpdushmtyyoh-uhfffaoysa-n
+
** lsqwciyrgvwpfx-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 277.378
+
** 268.225
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13677]]
+
* [[RXN-14240]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxy-2-nonenal-[l-cys] conjugate}}
+
{{#set: common-name=6,7-dehydrobaicalein}}
{{#set: inchi-key=inchikey=salpdushmtyyoh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=lsqwciyrgvwpfx-uhfffaoysa-n}}
{{#set: molecular-weight=277.378}}
+
{{#set: molecular-weight=268.225}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15172

  • common-name:
    • 6,7-dehydrobaicalein
  • smiles:
    • c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3)))
  • inchi-key:
    • lsqwciyrgvwpfx-uhfffaoysa-n
  • molecular-weight:
    • 268.225

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality