Difference between revisions of "CPD-15244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TYROSINE-DECARBOXYLASE-RXN TYROSINE-DECARBOXYLASE-RXN] == * direction: ** left-to-right * ec-number...")
(Created page with "Category:metabolite == Metabolite CPD-15244 == * common-name: ** 3-oxo-(5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TYROSINE-DECARBOXYLASE-RXN TYROSINE-DECARBOXYLASE-RXN] ==
+
== Metabolite CPD-15244 ==
* direction:
+
* common-name:
** left-to-right
+
** 3-oxo-(5z)-tetradecenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.1.1.25 ec-4.1.1.25]
+
** ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[PROTON]][c] '''+''' 1 [[TYR]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[TYRAMINE]][c]
+
** kadpwmjvuvwqnk-stfckwfxsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ11952]]
+
** 985.829
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-14393]]
== Pathway(s) ==
+
* [[RXN-14394]]
* [[PWY-5254]], methanofuran biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5254 PWY-5254]
+
== Reaction(s) known to produce the compound ==
** '''1''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-14393]]
* [[PWY-6133]], (S)-reticuline biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6133 PWY-6133]
+
== Reaction(s) of unknown directionality ==
** '''2''' reactions found over '''7''' reactions in the full pathway
+
{{#set: common-name=3-oxo-(5z)-tetradecenoyl-coa}}
* [[PWY-7297]], octopamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7297 PWY-7297]
+
{{#set: inchi-key=inchikey=kadpwmjvuvwqnk-stfckwfxsa-j}}
** '''1''' reactions found over '''2''' reactions in the full pathway
+
{{#set: molecular-weight=985.829}}
* [[PWY-6802]], salidroside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6802 PWY-6802]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7826]], Amaryllidacea alkaloids biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7826 PWY-7826]
 
** '''2''' reactions found over '''25''' reactions in the full pathway
 
* [[PWY-5474]], hydroxycinnamic acid tyramine amides biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5474 PWY-5474]
 
** '''1''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-3581]], (S)-reticuline biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3581 PWY-3581]
 
** '''6''' reactions found over '''11''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14346 14346]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00736 R00736]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/Q06086 Q06086]
 
** [http://www.uniprot.org/uniprot/P54768 P54768]
 
** [http://www.uniprot.org/uniprot/P54769 P54769]
 
** [http://www.uniprot.org/uniprot/P54770 P54770]
 
** [http://www.uniprot.org/uniprot/O82417 O82417]
 
** [http://www.uniprot.org/uniprot/P54771 P54771]
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-4.1.1.25}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=7}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15244

  • common-name:
    • 3-oxo-(5z)-tetradecenoyl-coa
  • smiles:
    • ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kadpwmjvuvwqnk-stfckwfxsa-j
  • molecular-weight:
    • 985.829

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality