Difference between revisions of "CPD-15244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HIF-Alpha == * common-name: ** a hypoxia inducible factor (hif) α subunit == Reaction(s) known to consume the compound == * RXN-1...")
(Created page with "Category:metabolite == Metabolite CPD-15244 == * common-name: ** 3-oxo-(5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HIF-Alpha ==
+
== Metabolite CPD-15244 ==
 
* common-name:
 
* common-name:
** a hypoxia inducible factor (hif) α subunit
+
** 3-oxo-(5z)-tetradecenoyl-coa
 +
* smiles:
 +
** ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** kadpwmjvuvwqnk-stfckwfxsa-j
 +
* molecular-weight:
 +
** 985.829
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11320]]
+
* [[RXN-14393]]
* [[RXN-11321]]
+
* [[RXN-14394]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14393]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a hypoxia inducible factor (hif) α subunit}}
+
{{#set: common-name=3-oxo-(5z)-tetradecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=kadpwmjvuvwqnk-stfckwfxsa-j}}
 +
{{#set: molecular-weight=985.829}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15244

  • common-name:
    • 3-oxo-(5z)-tetradecenoyl-coa
  • smiles:
    • ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kadpwmjvuvwqnk-stfckwfxsa-j
  • molecular-weight:
    • 985.829

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality