Difference between revisions of "CPD-15244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12826 == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) * inch...")
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N7-Methylguanine-46 == * common-name: ** an n7-methylguanine46 in trna == Reaction(s) known to consume the compound == ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12826 ==
+
== Metabolite tRNA-Containing-N7-Methylguanine-46 ==
 
* common-name:
 
* common-name:
** folate
+
** an n7-methylguanine46 in trna
* smiles:
 
** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3))
 
* inchi-key:
 
** ovbpiulpvideao-lbprgkrzsa-l
 
* molecular-weight:
 
** 439.387
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DHFOR]]
 
* [[FOLR2]]
 
* [[THFOR1]]
 
* [[THFOR2]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=folate}}
+
{{#set: common-name=an n7-methylguanine46 in trna}}
{{#set: inchi-key=inchikey=ovbpiulpvideao-lbprgkrzsa-l}}
 
{{#set: molecular-weight=439.387}}
 

Revision as of 14:59, 5 January 2021

Metabolite tRNA-Containing-N7-Methylguanine-46

  • common-name:
    • an n7-methylguanine46 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality