Difference between revisions of "CPD-15244"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TYROSINE-DECARBOXYLASE-RXN TYROSINE-DECARBOXYLASE-RXN] == * direction: ** left-to-right * ec-number...") |
(Created page with "Category:metabolite == Metabolite CPD-12826 == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) * inch...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12826 == |
− | * | + | * common-name: |
− | ** | + | ** folate |
− | * | + | * smiles: |
− | ** | + | ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) |
− | == | + | * inchi-key: |
− | + | ** ovbpiulpvideao-lbprgkrzsa-l | |
− | == | + | * molecular-weight: |
− | * | + | ** 439.387 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[DHFOR]] |
− | == | + | * [[FOLR2]] |
− | * [[ | + | * [[THFOR1]] |
− | + | * [[THFOR2]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | {{#set: common-name=folate}} |
− | + | {{#set: inchi-key=inchikey=ovbpiulpvideao-lbprgkrzsa-l}} | |
− | * [[ | + | {{#set: molecular-weight=439.387}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-12826
- common-name:
- folate
- smiles:
- c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3))
- inchi-key:
- ovbpiulpvideao-lbprgkrzsa-l
- molecular-weight:
- 439.387