Difference between revisions of "CPD-15279"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2184 == * common-name: ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate * smiles: ** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o...") |
(Created page with "Category:metabolite == Metabolite CPD-15279 == * common-name: ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide * smiles: ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15279 == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide |
* smiles: | * smiles: | ||
| − | ** c([o-])(=o)c= | + | ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sjhlsluuwibqns-tylceogasa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 460.481 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14430]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sjhlsluuwibqns-tylceogasa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=460.481}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-15279
- common-name:
- γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
- smiles:
- c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
- inchi-key:
- sjhlsluuwibqns-tylceogasa-m
- molecular-weight:
- 460.481
