Difference between revisions of "CPD-15279"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17920 RXN-17920] == * direction: ** left-to-right == Reaction formula == * 1 DNA-Ligase-L-lys...") |
(Created page with "Category:metabolite == Metabolite CPD-15279 == * common-name: ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide * smiles: ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15279 == |
| − | * | + | * common-name: |
| − | ** | + | ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide |
| − | + | * smiles: | |
| − | * | + | ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c |
| − | = | + | * inchi-key: |
| − | * | + | ** sjhlsluuwibqns-tylceogasa-m |
| − | ** | + | * molecular-weight: |
| − | * | + | ** 460.481 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-14430]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide}} |
| − | * | + | {{#set: inchi-key=inchikey=sjhlsluuwibqns-tylceogasa-m}} |
| − | == | + | {{#set: molecular-weight=460.481}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-15279
- common-name:
- γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
- smiles:
- c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
- inchi-key:
- sjhlsluuwibqns-tylceogasa-m
- molecular-weight:
- 460.481
