Difference between revisions of "CPD-15280"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-171 == * common-name: ** a dolichyl β-d-mannosyl phosphate == Reaction(s) known to consume the compound == * 2.4.1.109-RXN *...") |
(Created page with "Category:metabolite == Metabolite CPD-15280 == * common-name: ** hercynine * smiles: ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** gppytcrvkhuljh-qmmmgpobsa-n * m...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-15280 == |
* common-name: | * common-name: | ||
− | ** | + | ** hercynine |
+ | * smiles: | ||
+ | ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** gppytcrvkhuljh-qmmmgpobsa-n | ||
+ | * molecular-weight: | ||
+ | ** 197.236 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-14430]] | |
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=hercynine}} |
+ | {{#set: inchi-key=inchikey=gppytcrvkhuljh-qmmmgpobsa-n}} | ||
+ | {{#set: molecular-weight=197.236}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-15280
- common-name:
- hercynine
- smiles:
- c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-]
- inchi-key:
- gppytcrvkhuljh-qmmmgpobsa-n
- molecular-weight:
- 197.236